About N,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-b]indole-7-carboxamide
N,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-b]indole-7-carboxamide (PubChem CID 157037390) has the molecular formula C19H15F3N4O
and a molecular weight of 372.35 g/mol. Its IUPAC name is N,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-b]indole-7-carboxamide.
Molecular Properties
| Compound Name | N,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-b]indole-7-carboxamide |
| PubChem CID | 157037390 |
| Molecular Formula | C19H15F3N4O |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-b]indole-7-carboxamide |
| SMILES | CNC(=O)c1ccc2c(c1)c1nn(C)cc1n2-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15F3N4O/c1-23-18(27)11-3-8-15-14(9-11)17-16(10-25(2)24-17)26(15)13-6-4-12(5-7-13)19(20,21)22/h3-10H,1-2H3,(H,23,27) |
| InChIKey | PULCOQOKWZTPMW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-b]indole-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-b]indole-7-carboxamide?
The IUPAC name of N,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-b]indole-7-carboxamide (CID 157037390) is N,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-b]indole-7-carboxamide.
What is the SMILES notation for N,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-b]indole-7-carboxamide?
The canonical SMILES for N,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-b]indole-7-carboxamide is CNC(=O)c1ccc2c(c1)c1nn(C)cc1n2-c1ccc(C(F)(F)F)cc1.
What is the InChIKey of N,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-b]indole-7-carboxamide?
The InChIKey is PULCOQOKWZTPMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F3N4O/c1-23-18(27)11-3-8-15-14(9-11)17-16(10-25(2)24-17)26(15)13-6-4-12(5-7-13)19(20,21)22/h3-10H,1-2H3,(H,23,27).
What are the key properties of N,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-b]indole-7-carboxamide?
N,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-b]indole-7-carboxamide has a molecular weight of 372.35 g/mol, XLogP of 3.90, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-b]indole-7-carboxamide is sourced from PubChem (CID 157037390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).