C18H14F3N5O — CID 157038074
N,4-dimethyl-7-[4-(trifluoromethyl)phenyl]-4,5,7,9-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2,5,9,11-pentaene-11-carboxamide (PubChem CID 157038074) has the molecular formula C18H14F3N5O and a molecular weight of 373.34 g/mol. Its IUPAC name is N,4-dimethyl-7-[4-(trifluoromethyl)phenyl]-4,5,7,9-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2,5,9,11-pentaene-11-carboxamide.
| Compound Name | N,4-dimethyl-7-[4-(trifluoromethyl)phenyl]-4,5,7,9-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2,5,9,11-pentaene-11-carboxamide |
|---|---|
| PubChem CID | 157038074 |
| Molecular Formula | C18H14F3N5O |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N,4-dimethyl-7-[4-(trifluoromethyl)phenyl]-4,5,7,9-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2,5,9,11-pentaene-11-carboxamide |
| SMILES | CNC(=O)c1cnc2c(c1)c1cn(C)nc1n2-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H14F3N5O/c1-22-17(27)10-7-13-14-9-25(2)24-16(14)26(15(13)23-8-10)12-5-3-11(4-6-12)18(19,20)21/h3-9H,1-2H3,(H,22,27) |
| InChIKey | YHBWSWAVARXOAW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |