C31H27N3O5S2 — CID 11284713
ethyl 4,9-dioxo-3-[[(2S)-3-phenyl-2-(phenylcarbamothioylamino)propanoyl]amino]-2H-benzo[f][1]benzothiole-3-carboxylate (PubChem CID 11284713) has the molecular formula C31H27N3O5S2 and a molecular weight of 585.71 g/mol. Its IUPAC name is ethyl 4,9-dioxo-3-[[(2S)-3-phenyl-2-(phenylcarbamothioylamino)propanoyl]amino]-2H-benzo[f][1]benzothiole-3-carboxylate.
| Compound Name | ethyl 4,9-dioxo-3-[[(2S)-3-phenyl-2-(phenylcarbamothioylamino)propanoyl]amino]-2H-benzo[f][1]benzothiole-3-carboxylate |
|---|---|
| PubChem CID | 11284713 |
| Molecular Formula | C31H27N3O5S2 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.14 |
| IUPAC Name | ethyl 4,9-dioxo-3-[[(2S)-3-phenyl-2-(phenylcarbamothioylamino)propanoyl]amino]-2H-benzo[f][1]benzothiole-3-carboxylate |
| SMILES | CCOC(=O)C1(NC(=O)[C@H](Cc2ccccc2)NC(=S)Nc2ccccc2)CSC2=C1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C31H27N3O5S2/c1-2-39-29(38)31(18-41-27-24(31)25(35)21-15-9-10-16-22(21)26(27)36)34-28(37)23(17-19-11-5-3-6-12-19)33-30(40)32-20-13-7-4-8-14-20/h3-16,23H,2,17-18H2,1H3,(H,34,37)(H2,32,33,40)/t23-,31?/m0/s1 |
| InChIKey | FCILYTAVGHWBTQ-YNBNEFOKSA-N |
| XLogP | 4.08 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|