C17H13NO4 — CID 14856349
ethyl 2-oxo-3-(5-oxoindeno[1,2-b]pyridin-4-yl)propanoate (PubChem CID 14856349) has the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. Its IUPAC name is ethyl 2-oxo-3-(5-oxoindeno[1,2-b]pyridin-4-yl)propanoate.
| Compound Name | ethyl 2-oxo-3-(5-oxoindeno[1,2-b]pyridin-4-yl)propanoate |
|---|---|
| PubChem CID | 14856349 |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | ethyl 2-oxo-3-(5-oxoindeno[1,2-b]pyridin-4-yl)propanoate |
| SMILES | CCOC(=O)C(=O)Cc1ccnc2c1C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C17H13NO4/c1-2-22-17(21)13(19)9-10-7-8-18-15-11-5-3-4-6-12(11)16(20)14(10)15/h3-8H,2,9H2,1H3 |
| InChIKey | SZKHAHZCRAQYFI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|