C28H17NO4 — CID 10455426
ethyl 17,24-dioxo-15-azahexacyclo[12.12.0.02,7.08,13.016,25.018,23]hexacosa-1(26),2,4,6,8,10,12,14,16(25),18,20,22-dodecaene-26-carboxylate (PubChem CID 10455426) has the molecular formula C28H17NO4 and a molecular weight of 431.45 g/mol. Its IUPAC name is ethyl 17,24-dioxo-15-azahexacyclo[12.12.0.02,7.08,13.016,25.018,23]hexacosa-1(26),2,4,6,8,10,12,14,16(25),18,20,22-dodecaene-26-carboxylate.
| Compound Name | ethyl 17,24-dioxo-15-azahexacyclo[12.12.0.02,7.08,13.016,25.018,23]hexacosa-1(26),2,4,6,8,10,12,14,16(25),18,20,22-dodecaene-26-carboxylate |
|---|---|
| PubChem CID | 10455426 |
| Molecular Formula | C28H17NO4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | ethyl 17,24-dioxo-15-azahexacyclo[12.12.0.02,7.08,13.016,25.018,23]hexacosa-1(26),2,4,6,8,10,12,14,16(25),18,20,22-dodecaene-26-carboxylate |
| SMILES | CCOC(=O)c1c2c(nc3c4ccccc4c4ccccc4c13)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C28H17NO4/c1-2-33-28(32)22-21-17-11-5-3-9-15(17)16-10-4-6-12-18(16)24(21)29-25-23(22)26(30)19-13-7-8-14-20(19)27(25)31/h3-14H,2H2,1H3 |
| InChIKey | NIDGXISNOUROHA-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|