C16H12ClNO4 — CID 10710625
ethyl 2-(chloromethyl)-4,9-dioxo-1H-benzo[f]indole-3-carboxylate (PubChem CID 10710625) has the molecular formula C16H12ClNO4 and a molecular weight of 317.73 g/mol. Its IUPAC name is ethyl 2-(chloromethyl)-4,9-dioxo-1H-benzo[f]indole-3-carboxylate.
| Compound Name | ethyl 2-(chloromethyl)-4,9-dioxo-1H-benzo[f]indole-3-carboxylate |
|---|---|
| PubChem CID | 10710625 |
| Molecular Formula | C16H12ClNO4 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | ethyl 2-(chloromethyl)-4,9-dioxo-1H-benzo[f]indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CCl)[nH]c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H12ClNO4/c1-2-22-16(21)11-10(7-17)18-13-12(11)14(19)8-5-3-4-6-9(8)15(13)20/h3-6,18H,2,7H2,1H3 |
| InChIKey | FYILQEQKFODXOU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|