C21H12Cl2O4 — CID 101115879
ethyl 1,3-dichloro-6,11-dioxotetracene-5-carboxylate (PubChem CID 101115879) has the molecular formula C21H12Cl2O4 and a molecular weight of 399.23 g/mol. Its IUPAC name is ethyl 1,3-dichloro-6,11-dioxotetracene-5-carboxylate.
| Compound Name | ethyl 1,3-dichloro-6,11-dioxotetracene-5-carboxylate |
|---|---|
| PubChem CID | 101115879 |
| Molecular Formula | C21H12Cl2O4 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | ethyl 1,3-dichloro-6,11-dioxotetracene-5-carboxylate |
| SMILES | CCOC(=O)c1c2c(cc3c(Cl)cc(Cl)cc13)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H12Cl2O4/c1-2-27-21(26)18-14-7-10(22)8-16(23)13(14)9-15-17(18)20(25)12-6-4-3-5-11(12)19(15)24/h3-9H,2H2,1H3 |
| InChIKey | KPUVRLLIHWGNHQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|