C20H14Cl2O5 — CID 1324447
ethyl 2-[2,6-dichloro-4-[(1,3-dioxoinden-2-ylidene)methyl]phenoxy]acetate (PubChem CID 1324447) has the molecular formula C20H14Cl2O5 and a molecular weight of 405.23 g/mol. Its IUPAC name is ethyl 2-[2,6-dichloro-4-[(1,3-dioxoinden-2-ylidene)methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2,6-dichloro-4-[(1,3-dioxoinden-2-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 1324447 |
| Molecular Formula | C20H14Cl2O5 |
| Molecular Weight | 405.23 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | ethyl 2-[2,6-dichloro-4-[(1,3-dioxoinden-2-ylidene)methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(C=C2C(=O)c3ccccc3C2=O)cc1Cl |
| InChI | InChI=1S/C20H14Cl2O5/c1-2-26-17(23)10-27-20-15(21)8-11(9-16(20)22)7-14-18(24)12-5-3-4-6-13(12)19(14)25/h3-9H,2,10H2,1H3 |
| InChIKey | NZLNZKFYAYVLKJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.23 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|