C18H12BrClO3 — CID 1209448
2-[(3-bromo-5-chloro-4-ethoxyphenyl)methylidene]indene-1,3-dione (PubChem CID 1209448) has the molecular formula C18H12BrClO3 and a molecular weight of 391.65 g/mol. Its IUPAC name is 2-[(3-bromo-5-chloro-4-ethoxyphenyl)methylidene]indene-1,3-dione.
| Compound Name | 2-[(3-bromo-5-chloro-4-ethoxyphenyl)methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 1209448 |
| Molecular Formula | C18H12BrClO3 |
| Molecular Weight | 391.65 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | 2-[(3-bromo-5-chloro-4-ethoxyphenyl)methylidene]indene-1,3-dione |
| SMILES | CCOc1c(Cl)cc(C=C2C(=O)c3ccccc3C2=O)cc1Br |
| InChI | InChI=1S/C18H12BrClO3/c1-2-23-18-14(19)8-10(9-15(18)20)7-13-16(21)11-5-3-4-6-12(11)17(13)22/h3-9H,2H2,1H3 |
| InChIKey | UPWCOHBHIMDMPU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.65 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|