C23H18O4 — CID 101115860
ethyl 2,4-dimethyl-6,11-dioxotetracene-5-carboxylate (PubChem CID 101115860) has the molecular formula C23H18O4 and a molecular weight of 358.39 g/mol. Its IUPAC name is ethyl 2,4-dimethyl-6,11-dioxotetracene-5-carboxylate.
| Compound Name | ethyl 2,4-dimethyl-6,11-dioxotetracene-5-carboxylate |
|---|---|
| PubChem CID | 101115860 |
| Molecular Formula | C23H18O4 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | ethyl 2,4-dimethyl-6,11-dioxotetracene-5-carboxylate |
| SMILES | CCOC(=O)c1c2c(cc3cc(C)cc(C)c13)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H18O4/c1-4-27-23(26)20-18-13(3)9-12(2)10-14(18)11-17-19(20)22(25)16-8-6-5-7-15(16)21(17)24/h5-11H,4H2,1-3H3 |
| InChIKey | LVORDYAHXPAGSV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|