C22H19NO3 — CID 14341438
ethyl 3-benzyl-2-methyl-4-oxoindeno[2,1-b]pyrrole-1-carboxylate (PubChem CID 14341438) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is ethyl 3-benzyl-2-methyl-4-oxoindeno[2,1-b]pyrrole-1-carboxylate.
| Compound Name | ethyl 3-benzyl-2-methyl-4-oxoindeno[2,1-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 14341438 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | ethyl 3-benzyl-2-methyl-4-oxoindeno[2,1-b]pyrrole-1-carboxylate |
| SMILES | CCOC(=O)c1c2c(n(Cc3ccccc3)c1C)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C22H19NO3/c1-3-26-22(25)18-14(2)23(13-15-9-5-4-6-10-15)20-19(18)16-11-7-8-12-17(16)21(20)24/h4-12H,3,13H2,1-2H3 |
| InChIKey | XTAVLUYXWMXQQJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_I(2)', 'substructure': 'N/A'} |
|---|