C26H23NO5 — CID 90796257
ethyl 1-benzyl-4-hydroxy-2-oxo-7-phenylmethoxyquinoline-3-carboxylate (PubChem CID 90796257) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is ethyl 1-benzyl-4-hydroxy-2-oxo-7-phenylmethoxyquinoline-3-carboxylate.
| Compound Name | ethyl 1-benzyl-4-hydroxy-2-oxo-7-phenylmethoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 90796257 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | ethyl 1-benzyl-4-hydroxy-2-oxo-7-phenylmethoxyquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(O)c2ccc(OCc3ccccc3)cc2n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C26H23NO5/c1-2-31-26(30)23-24(28)21-14-13-20(32-17-19-11-7-4-8-12-19)15-22(21)27(25(23)29)16-18-9-5-3-6-10-18/h3-15,28H,2,16-17H2,1H3 |
| InChIKey | UZUMQBSKEMUMPM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |