C23H23IN4O3 — CID 134853353
ethyl 5-[(1-benzyl-5-iodotriazol-4-yl)methoxy]-1,2-dimethylindole-3-carboxylate (PubChem CID 134853353) has the molecular formula C23H23IN4O3 and a molecular weight of 530.37 g/mol. Its IUPAC name is ethyl 5-[(1-benzyl-5-iodotriazol-4-yl)methoxy]-1,2-dimethylindole-3-carboxylate.
| Compound Name | ethyl 5-[(1-benzyl-5-iodotriazol-4-yl)methoxy]-1,2-dimethylindole-3-carboxylate |
|---|---|
| PubChem CID | 134853353 |
| Molecular Formula | C23H23IN4O3 |
| Molecular Weight | 530.37 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | ethyl 5-[(1-benzyl-5-iodotriazol-4-yl)methoxy]-1,2-dimethylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(C)c2ccc(OCc3nnn(Cc4ccccc4)c3I)cc12 |
| InChI | InChI=1S/C23H23IN4O3/c1-4-30-23(29)21-15(2)27(3)20-11-10-17(12-18(20)21)31-14-19-22(24)28(26-25-19)13-16-8-6-5-7-9-16/h5-12H,4,13-14H2,1-3H3 |
| InChIKey | ZILVUXOWTNZTPC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|