C17H14BrNO4 — CID 141144049
ethyl 2-(bromomethyl)-3-methyl-4,5-dioxobenzo[e]indole-1-carboxylate (PubChem CID 141144049) has the molecular formula C17H14BrNO4 and a molecular weight of 376.21 g/mol. Its IUPAC name is ethyl 2-(bromomethyl)-3-methyl-4,5-dioxobenzo[e]indole-1-carboxylate.
| Compound Name | ethyl 2-(bromomethyl)-3-methyl-4,5-dioxobenzo[e]indole-1-carboxylate |
|---|---|
| PubChem CID | 141144049 |
| Molecular Formula | C17H14BrNO4 |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | ethyl 2-(bromomethyl)-3-methyl-4,5-dioxobenzo[e]indole-1-carboxylate |
| SMILES | CCOC(=O)c1c2c(n(C)c1CBr)C(=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C17H14BrNO4/c1-3-23-17(22)13-11(8-18)19(2)14-12(13)9-6-4-5-7-10(9)15(20)16(14)21/h4-7H,3,8H2,1-2H3 |
| InChIKey | UEKLEBOAGXRUAH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|