C22H17NO4 — CID 15417168
ethyl 2-benzyl-4,9-dioxo-1H-benzo[f]indole-3-carboxylate (PubChem CID 15417168) has the molecular formula C22H17NO4 and a molecular weight of 359.38 g/mol. Its IUPAC name is ethyl 2-benzyl-4,9-dioxo-1H-benzo[f]indole-3-carboxylate.
| Compound Name | ethyl 2-benzyl-4,9-dioxo-1H-benzo[f]indole-3-carboxylate |
|---|---|
| PubChem CID | 15417168 |
| Molecular Formula | C22H17NO4 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | ethyl 2-benzyl-4,9-dioxo-1H-benzo[f]indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(Cc2ccccc2)[nH]c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H17NO4/c1-2-27-22(26)17-16(12-13-8-4-3-5-9-13)23-19-18(17)20(24)14-10-6-7-11-15(14)21(19)25/h3-11,23H,2,12H2,1H3 |
| InChIKey | QTILZFGQZOHVOQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|