C17H15NO5 — CID 10828978
methyl 2-(methoxymethyl)-1-methyl-4,9-dioxobenzo[f]indole-3-carboxylate (PubChem CID 10828978) has the molecular formula C17H15NO5 and a molecular weight of 313.31 g/mol. Its IUPAC name is methyl 2-(methoxymethyl)-1-methyl-4,9-dioxobenzo[f]indole-3-carboxylate.
| Compound Name | methyl 2-(methoxymethyl)-1-methyl-4,9-dioxobenzo[f]indole-3-carboxylate |
|---|---|
| PubChem CID | 10828978 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | methyl 2-(methoxymethyl)-1-methyl-4,9-dioxobenzo[f]indole-3-carboxylate |
| SMILES | COCc1c(C(=O)OC)c2c(n1C)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H15NO5/c1-18-11(8-22-2)12(17(21)23-3)13-14(18)16(20)10-7-5-4-6-9(10)15(13)19/h4-7H,8H2,1-3H3 |
| InChIKey | IYQVYCPTJIMLFQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|