C15H9ClO5 — CID 118300484
methyl 2-(chloromethyl)-4,9-dioxobenzo[f][1]benzofuran-3-carboxylate (PubChem CID 118300484) has the molecular formula C15H9ClO5 and a molecular weight of 304.69 g/mol. Its IUPAC name is methyl 2-(chloromethyl)-4,9-dioxobenzo[f][1]benzofuran-3-carboxylate.
| Compound Name | methyl 2-(chloromethyl)-4,9-dioxobenzo[f][1]benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 118300484 |
| Molecular Formula | C15H9ClO5 |
| Molecular Weight | 304.69 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | methyl 2-(chloromethyl)-4,9-dioxobenzo[f][1]benzofuran-3-carboxylate |
| SMILES | COC(=O)c1c(CCl)oc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C15H9ClO5/c1-20-15(19)10-9(6-16)21-14-11(10)12(17)7-4-2-3-5-8(7)13(14)18/h2-5H,6H2,1H3 |
| InChIKey | UWNGRKBQOQIQJP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.69 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|