About 3-(3,4-dimethoxybenzoyl)-2-(trifluoromethyl)benzo[f][1]benzofuran-4,9-dione
3-(3,4-dimethoxybenzoyl)-2-(trifluoromethyl)benzo[f][1]benzofuran-4,9-dione (PubChem CID 1046630) has the molecular formula C22H13F3O6
and a molecular weight of 430.33 g/mol. Its IUPAC name is 3-(3,4-dimethoxybenzoyl)-2-(trifluoromethyl)benzo[f][1]benzofuran-4,9-dione.
Molecular Properties
| Compound Name | 3-(3,4-dimethoxybenzoyl)-2-(trifluoromethyl)benzo[f][1]benzofuran-4,9-dione |
| PubChem CID | 1046630 |
| Molecular Formula | C22H13F3O6 |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 3-(3,4-dimethoxybenzoyl)-2-(trifluoromethyl)benzo[f][1]benzofuran-4,9-dione |
| SMILES | COc1ccc(C(=O)c2c(C(F)(F)F)oc3c2C(=O)c2ccccc2C3=O)cc1OC |
| InChI | InChI=1S/C22H13F3O6/c1-29-13-8-7-10(9-14(13)30-2)17(26)16-15-18(27)11-5-3-4-6-12(11)19(28)20(15)31-21(16)22(23,24)25/h3-9H,1-2H3 |
| InChIKey | OQUKXIHLWYORRF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dimethoxybenzoyl)-2-(trifluoromethyl)benzo[f][1]benzofuran-4,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethoxybenzoyl)-2-(trifluoromethyl)benzo[f][1]benzofuran-4,9-dione?
The IUPAC name of 3-(3,4-dimethoxybenzoyl)-2-(trifluoromethyl)benzo[f][1]benzofuran-4,9-dione (CID 1046630) is 3-(3,4-dimethoxybenzoyl)-2-(trifluoromethyl)benzo[f][1]benzofuran-4,9-dione.
What is the SMILES notation for 3-(3,4-dimethoxybenzoyl)-2-(trifluoromethyl)benzo[f][1]benzofuran-4,9-dione?
The canonical SMILES for 3-(3,4-dimethoxybenzoyl)-2-(trifluoromethyl)benzo[f][1]benzofuran-4,9-dione is COc1ccc(C(=O)c2c(C(F)(F)F)oc3c2C(=O)c2ccccc2C3=O)cc1OC.
What is the InChIKey of 3-(3,4-dimethoxybenzoyl)-2-(trifluoromethyl)benzo[f][1]benzofuran-4,9-dione?
The InChIKey is OQUKXIHLWYORRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13F3O6/c1-29-13-8-7-10(9-14(13)30-2)17(26)16-15-18(27)11-5-3-4-6-12(11)19(28)20(15)31-21(16)22(23,24)25/h3-9H,1-2H3.
What are the key properties of 3-(3,4-dimethoxybenzoyl)-2-(trifluoromethyl)benzo[f][1]benzofuran-4,9-dione?
3-(3,4-dimethoxybenzoyl)-2-(trifluoromethyl)benzo[f][1]benzofuran-4,9-dione has a molecular weight of 430.33 g/mol, XLogP of 4.32, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethoxybenzoyl)-2-(trifluoromethyl)benzo[f][1]benzofuran-4,9-dione is sourced from PubChem (CID 1046630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).