C18H16N2O6 — CID 19034276
N-(2-hydroxy-1,3-dioxoinden-2-yl)-3,4-dimethoxybenzohydrazide (PubChem CID 19034276) has the molecular formula C18H16N2O6 and a molecular weight of 356.33 g/mol. Its IUPAC name is N-(2-hydroxy-1,3-dioxoinden-2-yl)-3,4-dimethoxybenzohydrazide.
| Compound Name | N-(2-hydroxy-1,3-dioxoinden-2-yl)-3,4-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 19034276 |
| Molecular Formula | C18H16N2O6 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-(2-hydroxy-1,3-dioxoinden-2-yl)-3,4-dimethoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)N(N)C2(O)C(=O)c3ccccc3C2=O)cc1OC |
| InChI | InChI=1S/C18H16N2O6/c1-25-13-8-7-10(9-14(13)26-2)17(23)20(19)18(24)15(21)11-5-3-4-6-12(11)16(18)22/h3-9,24H,19H2,1-2H3 |
| InChIKey | HNBPXLPAODCQSD-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|