C34H26O13 — CID 157110792
methyl 2-acetyl-4,9-dioxobenzo[f][1]benzofuran-3-carboxylate;methyl 2-(1,1-dimethoxyethyl)-4,9-dioxobenzo[f][1]benzofuran-3-carboxylate (PubChem CID 157110792) has the molecular formula C34H26O13 and a molecular weight of 642.57 g/mol. Its IUPAC name is methyl 2-acetyl-4,9-dioxobenzo[f][1]benzofuran-3-carboxylate;methyl 2-(1,1-dimethoxyethyl)-4,9-dioxobenzo[f][1]benzofuran-3-carboxylate.
| Compound Name | methyl 2-acetyl-4,9-dioxobenzo[f][1]benzofuran-3-carboxylate;methyl 2-(1,1-dimethoxyethyl)-4,9-dioxobenzo[f][1]benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 157110792 |
| Molecular Formula | C34H26O13 |
| Molecular Weight | 642.57 g/mol |
| Exact Mass | 642.14 |
| IUPAC Name | methyl 2-acetyl-4,9-dioxobenzo[f][1]benzofuran-3-carboxylate;methyl 2-(1,1-dimethoxyethyl)-4,9-dioxobenzo[f][1]benzofuran-3-carboxylate |
| SMILES | COC(=O)c1c(C(C)(OC)OC)oc2c1C(=O)c1ccccc1C2=O.COC(=O)c1c(C(C)=O)oc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H16O7.C16H10O6/c1-18(23-3,24-4)16-12(17(21)22-2)11-13(19)9-7-5-6-8-10(9)14(20)15(11)25-16;1-7(17)14-11(16(20)21-2)10-12(18)8-5-3-4-6-9(8)13(19)15(10)22-14/h5-8H,1-4H3;3-6H,1-2H3 |
| InChIKey | AGVBAACWTONDDW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 182.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|