C20H22N2O7S — CID 144900904
2-(1-hydroxy-1-methoxyethyl)-3-(4-methylpiperazin-1-yl)sulfonylbenzo[f][1]benzofuran-4,9-dione (PubChem CID 144900904) has the molecular formula C20H22N2O7S and a molecular weight of 434.47 g/mol. Its IUPAC name is 2-(1-hydroxy-1-methoxyethyl)-3-(4-methylpiperazin-1-yl)sulfonylbenzo[f][1]benzofuran-4,9-dione.
| Compound Name | 2-(1-hydroxy-1-methoxyethyl)-3-(4-methylpiperazin-1-yl)sulfonylbenzo[f][1]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 144900904 |
| Molecular Formula | C20H22N2O7S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 2-(1-hydroxy-1-methoxyethyl)-3-(4-methylpiperazin-1-yl)sulfonylbenzo[f][1]benzofuran-4,9-dione |
| SMILES | COC(C)(O)c1oc2c(c1S(=O)(=O)N1CCN(C)CC1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H22N2O7S/c1-20(25,28-3)19-18(30(26,27)22-10-8-21(2)9-11-22)14-15(23)12-6-4-5-7-13(12)16(24)17(14)29-19/h4-7,25H,8-11H2,1-3H3 |
| InChIKey | ZLKXVAZVBCZDAY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|