C18H15NO6S — CID 27307489
N-[(3R)-1,1-dioxothiolan-3-yl]-2-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carboxamide (PubChem CID 27307489) has the molecular formula C18H15NO6S and a molecular weight of 373.39 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-2-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carboxamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 27307489 |
| Molecular Formula | C18H15NO6S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carboxamide |
| SMILES | Cc1oc2c(c1C(=O)N[C@@H]1CCS(=O)(=O)C1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H15NO6S/c1-9-13(18(22)19-10-6-7-26(23,24)8-10)14-15(20)11-4-2-3-5-12(11)16(21)17(14)25-9/h2-5,10H,6-8H2,1H3,(H,19,22)/t10-/m1/s1 |
| InChIKey | VZHQWOTXADCMHA-SNVBAGLBSA-N |
| XLogP | 1.28 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|