C21H19NO5S — CID 40946836
N-[(3S)-1,1-dioxothiolan-3-yl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide (PubChem CID 40946836) has the molecular formula C21H19NO5S and a molecular weight of 397.45 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide |
|---|---|
| PubChem CID | 40946836 |
| Molecular Formula | C21H19NO5S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)N[C@H]3CCS(=O)(=O)C3)cccc2c1=O |
| InChI | InChI=1S/C21H19NO5S/c1-13-18(23)16-8-5-9-17(21(24)22-15-10-11-28(25,26)12-15)20(16)27-19(13)14-6-3-2-4-7-14/h2-9,15H,10-12H2,1H3,(H,22,24)/t15-/m0/s1 |
| InChIKey | REVSFBKTPLDTGH-HNNXBMFYSA-N |
| XLogP | 2.69 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |