C23H21N3O3 — CID 166291812
N-(4-cyanopiperidin-3-yl)-3-methyl-4-oxo-2-phenylchromene-8-carboxamide (PubChem CID 166291812) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-(4-cyanopiperidin-3-yl)-3-methyl-4-oxo-2-phenylchromene-8-carboxamide.
| Compound Name | N-(4-cyanopiperidin-3-yl)-3-methyl-4-oxo-2-phenylchromene-8-carboxamide |
|---|---|
| PubChem CID | 166291812 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-(4-cyanopiperidin-3-yl)-3-methyl-4-oxo-2-phenylchromene-8-carboxamide |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)NC3CNCCC3C#N)cccc2c1=O |
| InChI | InChI=1S/C23H21N3O3/c1-14-20(27)17-8-5-9-18(22(17)29-21(14)15-6-3-2-4-7-15)23(28)26-19-13-25-11-10-16(19)12-24/h2-9,16,19,25H,10-11,13H2,1H3,(H,26,28) |
| InChIKey | KDGUVSZWNYRBRW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |