C16H16ClN3O4S2 — CID 6597474
3-(2-chlorophenyl)-N-[[(3S)-1,1-dioxothiolan-3-yl]carbamothioyl]-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 6597474) has the molecular formula C16H16ClN3O4S2 and a molecular weight of 413.91 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[[(3S)-1,1-dioxothiolan-3-yl]carbamothioyl]-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2-chlorophenyl)-N-[[(3S)-1,1-dioxothiolan-3-yl]carbamothioyl]-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 6597474 |
| Molecular Formula | C16H16ClN3O4S2 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[[(3S)-1,1-dioxothiolan-3-yl]carbamothioyl]-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2ccccc2Cl)c1C(=O)NC(=S)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H16ClN3O4S2/c1-9-13(14(20-24-9)11-4-2-3-5-12(11)17)15(21)19-16(25)18-10-6-7-26(22,23)8-10/h2-5,10H,6-8H2,1H3,(H2,18,19,21,25)/t10-/m0/s1 |
| InChIKey | ZBTBQPSHEFAKKH-JTQLQIEISA-N |
| XLogP | 2.09 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|