C19H19NO3 — CID 101075588
1,2-diethyl-3-propanoylbenzo[f]indole-4,9-dione (PubChem CID 101075588) has the molecular formula C19H19NO3 and a molecular weight of 309.36 g/mol. Its IUPAC name is 1,2-diethyl-3-propanoylbenzo[f]indole-4,9-dione.
| Compound Name | 1,2-diethyl-3-propanoylbenzo[f]indole-4,9-dione |
|---|---|
| PubChem CID | 101075588 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 1,2-diethyl-3-propanoylbenzo[f]indole-4,9-dione |
| SMILES | CCC(=O)c1c2c(n(CC)c1CC)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H19NO3/c1-4-13-15(14(21)5-2)16-17(20(13)6-3)19(23)12-10-8-7-9-11(12)18(16)22/h7-10H,4-6H2,1-3H3 |
| InChIKey | MOQYXQLEAJZHKC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|