C23H20BrNO2 — CID 177268383
ethyl 2-(bromomethyl)-1-methyl-6-naphthalen-2-ylindole-3-carboxylate (PubChem CID 177268383) has the molecular formula C23H20BrNO2 and a molecular weight of 422.32 g/mol. Its IUPAC name is ethyl 2-(bromomethyl)-1-methyl-6-naphthalen-2-ylindole-3-carboxylate.
| Compound Name | ethyl 2-(bromomethyl)-1-methyl-6-naphthalen-2-ylindole-3-carboxylate |
|---|---|
| PubChem CID | 177268383 |
| Molecular Formula | C23H20BrNO2 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | ethyl 2-(bromomethyl)-1-methyl-6-naphthalen-2-ylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CBr)n(C)c2cc(-c3ccc4ccccc4c3)ccc12 |
| InChI | InChI=1S/C23H20BrNO2/c1-3-27-23(26)22-19-11-10-18(13-20(19)25(2)21(22)14-24)17-9-8-15-6-4-5-7-16(15)12-17/h4-13H,3,14H2,1-2H3 |
| InChIKey | ZBFYIRZCJXZGDC-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|