C19H24N2O2 — CID 163883095
ethyl 2-(aminomethyl)-6-(cyclohexen-1-yl)-1-methylindole-3-carboxylate (PubChem CID 163883095) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is ethyl 2-(aminomethyl)-6-(cyclohexen-1-yl)-1-methylindole-3-carboxylate.
| Compound Name | ethyl 2-(aminomethyl)-6-(cyclohexen-1-yl)-1-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 163883095 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | ethyl 2-(aminomethyl)-6-(cyclohexen-1-yl)-1-methylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CN)n(C)c2cc(C3=CCCCC3)ccc12 |
| InChI | InChI=1S/C19H24N2O2/c1-3-23-19(22)18-15-10-9-14(13-7-5-4-6-8-13)11-16(15)21(2)17(18)12-20/h7,9-11H,3-6,8,12,20H2,1-2H3 |
| InChIKey | PUZGYNKRPWJDGH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |