C25H25N3O2 — CID 170077280
ethyl 2-[(aminomethylideneamino)methyl]-1-methyl-6-(5-methylnaphthalen-1-yl)indole-3-carboxylate (PubChem CID 170077280) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is ethyl 2-[(aminomethylideneamino)methyl]-1-methyl-6-(5-methylnaphthalen-1-yl)indole-3-carboxylate.
| Compound Name | ethyl 2-[(aminomethylideneamino)methyl]-1-methyl-6-(5-methylnaphthalen-1-yl)indole-3-carboxylate |
|---|---|
| PubChem CID | 170077280 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | ethyl 2-[(aminomethylideneamino)methyl]-1-methyl-6-(5-methylnaphthalen-1-yl)indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C/N=C/N)n(C)c2cc(-c3cccc4c(C)cccc34)ccc12 |
| InChI | InChI=1S/C25H25N3O2/c1-4-30-25(29)24-21-12-11-17(13-22(21)28(3)23(24)14-27-15-26)19-9-6-8-18-16(2)7-5-10-20(18)19/h5-13,15H,4,14H2,1-3H3,(H2,26,27) |
| InChIKey | YJTOSTXFGIPPNR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|