C23H22N4O2 — CID 170077241
ethyl 2-[(aminomethylideneamino)methyl]-6-isoquinolin-8-yl-1-methylindole-3-carboxylate (PubChem CID 170077241) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is ethyl 2-[(aminomethylideneamino)methyl]-6-isoquinolin-8-yl-1-methylindole-3-carboxylate.
| Compound Name | ethyl 2-[(aminomethylideneamino)methyl]-6-isoquinolin-8-yl-1-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 170077241 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | ethyl 2-[(aminomethylideneamino)methyl]-6-isoquinolin-8-yl-1-methylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C/N=C/N)n(C)c2cc(-c3cccc4ccncc34)ccc12 |
| InChI | InChI=1S/C23H22N4O2/c1-3-29-23(28)22-18-8-7-16(11-20(18)27(2)21(22)13-26-14-24)17-6-4-5-15-9-10-25-12-19(15)17/h4-12,14H,3,13H2,1-2H3,(H2,24,26) |
| InChIKey | GDMZCVXHMVFMRV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|