C23H21ClN2O2 — CID 170075614
ethyl 2-(aminomethyl)-6-(8-chloronaphthalen-1-yl)-1-methylindole-3-carboxylate (PubChem CID 170075614) has the molecular formula C23H21ClN2O2 and a molecular weight of 392.89 g/mol. Its IUPAC name is ethyl 2-(aminomethyl)-6-(8-chloronaphthalen-1-yl)-1-methylindole-3-carboxylate.
| Compound Name | ethyl 2-(aminomethyl)-6-(8-chloronaphthalen-1-yl)-1-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 170075614 |
| Molecular Formula | C23H21ClN2O2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | ethyl 2-(aminomethyl)-6-(8-chloronaphthalen-1-yl)-1-methylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CN)n(C)c2cc(-c3cccc4cccc(Cl)c34)ccc12 |
| InChI | InChI=1S/C23H21ClN2O2/c1-3-28-23(27)22-17-11-10-15(12-19(17)26(2)20(22)13-25)16-8-4-6-14-7-5-9-18(24)21(14)16/h4-12H,3,13,25H2,1-2H3 |
| InChIKey | DCHDAENPPPTMIO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |