C28H28N2O2 — CID 170076574
ethyl 2-(aminomethyl)-6-(cyclopenten-1-yl)-1-methyl-5-naphthalen-1-ylindole-3-carboxylate (PubChem CID 170076574) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is ethyl 2-(aminomethyl)-6-(cyclopenten-1-yl)-1-methyl-5-naphthalen-1-ylindole-3-carboxylate.
| Compound Name | ethyl 2-(aminomethyl)-6-(cyclopenten-1-yl)-1-methyl-5-naphthalen-1-ylindole-3-carboxylate |
|---|---|
| PubChem CID | 170076574 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | ethyl 2-(aminomethyl)-6-(cyclopenten-1-yl)-1-methyl-5-naphthalen-1-ylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CN)n(C)c2cc(C3=CCCC3)c(-c3cccc4ccccc34)cc12 |
| InChI | InChI=1S/C28H28N2O2/c1-3-32-28(31)27-24-15-23(21-14-8-12-18-9-6-7-13-20(18)21)22(19-10-4-5-11-19)16-25(24)30(2)26(27)17-29/h6-10,12-16H,3-5,11,17,29H2,1-2H3 |
| InChIKey | AVSNIOZEYQYKKI-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |