C20H26N4O2 — CID 163985158
ethyl 6-(cyclohexen-1-yl)-2-[(diaminomethylideneamino)methyl]-1-methylindole-3-carboxylate (PubChem CID 163985158) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is ethyl 6-(cyclohexen-1-yl)-2-[(diaminomethylideneamino)methyl]-1-methylindole-3-carboxylate.
| Compound Name | ethyl 6-(cyclohexen-1-yl)-2-[(diaminomethylideneamino)methyl]-1-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 163985158 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | ethyl 6-(cyclohexen-1-yl)-2-[(diaminomethylideneamino)methyl]-1-methylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CN=C(N)N)n(C)c2cc(C3=CCCCC3)ccc12 |
| InChI | InChI=1S/C20H26N4O2/c1-3-26-19(25)18-15-10-9-14(13-7-5-4-6-8-13)11-16(15)24(2)17(18)12-23-20(21)22/h7,9-11H,3-6,8,12H2,1-2H3,(H4,21,22,23) |
| InChIKey | TVQLTGSAOBANMV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|