C31H39N3O2 — CID 170071670
ethyl 2-(5-amino-5-iminopentyl)-1-methyl-6-(1,2,3,4,5,6,7,8-octahydroanthracen-9-yl)indole-3-carboxylate (PubChem CID 170071670) has the molecular formula C31H39N3O2 and a molecular weight of 485.67 g/mol. Its IUPAC name is ethyl 2-(5-amino-5-iminopentyl)-1-methyl-6-(1,2,3,4,5,6,7,8-octahydroanthracen-9-yl)indole-3-carboxylate.
| Compound Name | ethyl 2-(5-amino-5-iminopentyl)-1-methyl-6-(1,2,3,4,5,6,7,8-octahydroanthracen-9-yl)indole-3-carboxylate |
|---|---|
| PubChem CID | 170071670 |
| Molecular Formula | C31H39N3O2 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | ethyl 2-(5-amino-5-iminopentyl)-1-methyl-6-(1,2,3,4,5,6,7,8-octahydroanthracen-9-yl)indole-3-carboxylate |
| SMILES | [H]/N=C(\N)CCCCc1c(C(=O)OCC)c2ccc(-c3c4c(cc5c3CCCC5)CCCC4)cc2n1C |
| InChI | InChI=1S/C31H39N3O2/c1-3-36-31(35)30-25-17-16-22(19-27(25)34(2)26(30)14-8-9-15-28(32)33)29-23-12-6-4-10-20(23)18-21-11-5-7-13-24(21)29/h16-19H,3-15H2,1-2H3,(H3,32,33) |
| InChIKey | RRZVYFYSABJSSG-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|