C19H26O4 — CID 102151340
diethyl 3-methyl-5,6,7,8,9,10-hexahydrobenzo[8]annulene-2,4-dicarboxylate (PubChem CID 102151340) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is diethyl 3-methyl-5,6,7,8,9,10-hexahydrobenzo[8]annulene-2,4-dicarboxylate.
| Compound Name | diethyl 3-methyl-5,6,7,8,9,10-hexahydrobenzo[8]annulene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 102151340 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | diethyl 3-methyl-5,6,7,8,9,10-hexahydrobenzo[8]annulene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1cc2c(c(C(=O)OCC)c1C)CCCCCC2 |
| InChI | InChI=1S/C19H26O4/c1-4-22-18(20)16-12-14-10-8-6-7-9-11-15(14)17(13(16)3)19(21)23-5-2/h12H,4-11H2,1-3H3 |
| InChIKey | SLGSIUNTZKYPBH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |