C20H20BrNO2 — CID 23243976
ethyl 4-(4-bromophenyl)-1,2,6-trimethylindole-5-carboxylate (PubChem CID 23243976) has the molecular formula C20H20BrNO2 and a molecular weight of 386.29 g/mol. Its IUPAC name is ethyl 4-(4-bromophenyl)-1,2,6-trimethylindole-5-carboxylate.
| Compound Name | ethyl 4-(4-bromophenyl)-1,2,6-trimethylindole-5-carboxylate |
|---|---|
| PubChem CID | 23243976 |
| Molecular Formula | C20H20BrNO2 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | ethyl 4-(4-bromophenyl)-1,2,6-trimethylindole-5-carboxylate |
| SMILES | CCOC(=O)c1c(C)cc2c(cc(C)n2C)c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H20BrNO2/c1-5-24-20(23)18-12(2)10-17-16(11-13(3)22(17)4)19(18)14-6-8-15(21)9-7-14/h6-11H,5H2,1-4H3 |
| InChIKey | GLKIAPFZXFUMTE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |