C24H22FN3O2 — CID 170077353
ethyl 2-[(aminomethylideneamino)methyl]-6-(3-fluoronaphthalen-1-yl)-1-methylindole-3-carboxylate (PubChem CID 170077353) has the molecular formula C24H22FN3O2 and a molecular weight of 403.46 g/mol. Its IUPAC name is ethyl 2-[(aminomethylideneamino)methyl]-6-(3-fluoronaphthalen-1-yl)-1-methylindole-3-carboxylate.
| Compound Name | ethyl 2-[(aminomethylideneamino)methyl]-6-(3-fluoronaphthalen-1-yl)-1-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 170077353 |
| Molecular Formula | C24H22FN3O2 |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | ethyl 2-[(aminomethylideneamino)methyl]-6-(3-fluoronaphthalen-1-yl)-1-methylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C/N=C/N)n(C)c2cc(-c3cc(F)cc4ccccc34)ccc12 |
| InChI | InChI=1S/C24H22FN3O2/c1-3-30-24(29)23-19-9-8-16(11-21(19)28(2)22(23)13-27-14-26)20-12-17(25)10-15-6-4-5-7-18(15)20/h4-12,14H,3,13H2,1-2H3,(H2,26,27) |
| InChIKey | WCKFEWLAPBERAN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|