C24H23BrN2O2 — CID 170078093
ethyl 6-bromo-1-methyl-2-(methylaminomethyl)-5-naphthalen-1-ylindole-3-carboxylate (PubChem CID 170078093) has the molecular formula C24H23BrN2O2 and a molecular weight of 451.36 g/mol. Its IUPAC name is ethyl 6-bromo-1-methyl-2-(methylaminomethyl)-5-naphthalen-1-ylindole-3-carboxylate.
| Compound Name | ethyl 6-bromo-1-methyl-2-(methylaminomethyl)-5-naphthalen-1-ylindole-3-carboxylate |
|---|---|
| PubChem CID | 170078093 |
| Molecular Formula | C24H23BrN2O2 |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | ethyl 6-bromo-1-methyl-2-(methylaminomethyl)-5-naphthalen-1-ylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CNC)n(C)c2cc(Br)c(-c3cccc4ccccc34)cc12 |
| InChI | InChI=1S/C24H23BrN2O2/c1-4-29-24(28)23-19-12-18(17-11-7-9-15-8-5-6-10-16(15)17)20(25)13-21(19)27(3)22(23)14-26-2/h5-13,26H,4,14H2,1-3H3 |
| InChIKey | VOVHZRKWZFDMHR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |