C19H17BrFNO3 — CID 141375125
ethyl 6-bromo-2-[(4-fluorophenyl)methyl]-5-hydroxy-1-methylindole-3-carboxylate (PubChem CID 141375125) has the molecular formula C19H17BrFNO3 and a molecular weight of 406.25 g/mol. Its IUPAC name is ethyl 6-bromo-2-[(4-fluorophenyl)methyl]-5-hydroxy-1-methylindole-3-carboxylate.
| Compound Name | ethyl 6-bromo-2-[(4-fluorophenyl)methyl]-5-hydroxy-1-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 141375125 |
| Molecular Formula | C19H17BrFNO3 |
| Molecular Weight | 406.25 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | ethyl 6-bromo-2-[(4-fluorophenyl)methyl]-5-hydroxy-1-methylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(Cc2ccc(F)cc2)n(C)c2cc(Br)c(O)cc12 |
| InChI | InChI=1S/C19H17BrFNO3/c1-3-25-19(24)18-13-9-17(23)14(20)10-15(13)22(2)16(18)8-11-4-6-12(21)7-5-11/h4-7,9-10,23H,3,8H2,1-2H3 |
| InChIKey | WEMOBJTWEWZKDG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.25 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |