C21H19BrFNO4 — CID 141375115
ethyl 5-acetyloxy-6-bromo-2-[(4-fluorophenyl)methyl]-1-methylindole-3-carboxylate (PubChem CID 141375115) has the molecular formula C21H19BrFNO4 and a molecular weight of 448.29 g/mol. Its IUPAC name is ethyl 5-acetyloxy-6-bromo-2-[(4-fluorophenyl)methyl]-1-methylindole-3-carboxylate.
| Compound Name | ethyl 5-acetyloxy-6-bromo-2-[(4-fluorophenyl)methyl]-1-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 141375115 |
| Molecular Formula | C21H19BrFNO4 |
| Molecular Weight | 448.29 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | ethyl 5-acetyloxy-6-bromo-2-[(4-fluorophenyl)methyl]-1-methylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(Cc2ccc(F)cc2)n(C)c2cc(Br)c(OC(C)=O)cc12 |
| InChI | InChI=1S/C21H19BrFNO4/c1-4-27-21(26)20-15-10-19(28-12(2)25)16(22)11-17(15)24(3)18(20)9-13-5-7-14(23)8-6-13/h5-8,10-11H,4,9H2,1-3H3 |
| InChIKey | XDSFGIZXMINSKW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.29 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|