C18H16BrNO3 — CID 150341853
6-bromo-5-hydroxy-1-methyl-2-[(4-methylphenyl)methyl]indole-3-carboxylic acid (PubChem CID 150341853) has the molecular formula C18H16BrNO3 and a molecular weight of 374.23 g/mol. Its IUPAC name is 6-bromo-5-hydroxy-1-methyl-2-[(4-methylphenyl)methyl]indole-3-carboxylic acid.
| Compound Name | 6-bromo-5-hydroxy-1-methyl-2-[(4-methylphenyl)methyl]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 150341853 |
| Molecular Formula | C18H16BrNO3 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 6-bromo-5-hydroxy-1-methyl-2-[(4-methylphenyl)methyl]indole-3-carboxylic acid |
| SMILES | Cc1ccc(Cc2c(C(=O)O)c3cc(O)c(Br)cc3n2C)cc1 |
| InChI | InChI=1S/C18H16BrNO3/c1-10-3-5-11(6-4-10)7-15-17(18(22)23)12-8-16(21)13(19)9-14(12)20(15)2/h3-6,8-9,21H,7H2,1-2H3,(H,22,23) |
| InChIKey | GRWKKDRYXYBFHF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |