C21H16O3 — CID 10881615
ethyl 10-methyl-8-oxotetracyclo[7.7.1.02,7.012,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene-11-carboxylate (PubChem CID 10881615) has the molecular formula C21H16O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is ethyl 10-methyl-8-oxotetracyclo[7.7.1.02,7.012,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene-11-carboxylate.
| Compound Name | ethyl 10-methyl-8-oxotetracyclo[7.7.1.02,7.012,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene-11-carboxylate |
|---|---|
| PubChem CID | 10881615 |
| Molecular Formula | C21H16O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | ethyl 10-methyl-8-oxotetracyclo[7.7.1.02,7.012,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene-11-carboxylate |
| SMILES | CCOC(=O)c1c(C)c2c(=O)c3ccccc3c3ccccc1c23 |
| InChI | InChI=1S/C21H16O3/c1-3-24-21(23)17-12(2)18-19-14(9-5-7-11-16(17)19)13-8-4-6-10-15(13)20(18)22/h4-11H,3H2,1-2H3 |
| InChIKey | GQWVQPTXASUUSE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azulene(4)', 'substructure': 'N/A'} |
|---|