C19H15NO2 — CID 15639090
ethyl 2H-phenanthro[9,10-c]pyrrole-3-carboxylate (PubChem CID 15639090) has the molecular formula C19H15NO2 and a molecular weight of 289.33 g/mol. Its IUPAC name is ethyl 2H-phenanthro[9,10-c]pyrrole-3-carboxylate.
| Compound Name | ethyl 2H-phenanthro[9,10-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 15639090 |
| Molecular Formula | C19H15NO2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | ethyl 2H-phenanthro[9,10-c]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1[nH]cc2c3ccccc3c3ccccc3c12 |
| InChI | InChI=1S/C19H15NO2/c1-2-22-19(21)18-17-15-10-6-5-8-13(15)12-7-3-4-9-14(12)16(17)11-20-18/h3-11,20H,2H2,1H3 |
| InChIKey | MTHUBCJLUNMAOH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|