C23H22N3O5+ — CID 121478324
3-[4-(dimethylamino)pyridin-1-ium-1-yl]propyl 2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylate (PubChem CID 121478324) has the molecular formula C23H22N3O5+ and a molecular weight of 420.45 g/mol. Its IUPAC name is 3-[4-(dimethylamino)pyridin-1-ium-1-yl]propyl 2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylate.
| Compound Name | 3-[4-(dimethylamino)pyridin-1-ium-1-yl]propyl 2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 121478324 |
| Molecular Formula | C23H22N3O5+ |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 3-[4-(dimethylamino)pyridin-1-ium-1-yl]propyl 2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylate |
| SMILES | Cc1oc2c(c1C(=O)OCCC[n+]1ccc(N(C)C)cc1)C(=O)c1ncccc1C2=O |
| InChI | InChI=1S/C23H22N3O5/c1-14-17(18-21(28)19-16(6-4-9-24-19)20(27)22(18)31-14)23(29)30-13-5-10-26-11-7-15(8-12-26)25(2)3/h4,6-9,11-12H,5,10,13H2,1-3H3/q+1 |
| InChIKey | XZDFSMDCOOEURC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 93.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|