2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylic acid

C13H7NO5 — CID 121472574

IUPAC2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylic acid
SMILESCc1oc2c(c1C(=O)O)C(=O)c1ncccc1C2=O
InChIInChI=1S/C13H7NO5/c1-5-7(13(17)18)8-11(16)9-6(3-2-4-14-9)10(15)12(8)19-5/h2-4H,1H3,(H,17,18)
InChIKeyGCPJQRYMHLEJQY-UHFFFAOYSA-N
MW257.20 g/mol
LogP1.46
Rot. Bonds1

About 2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylic acid

2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylic acid (PubChem CID 121472574) has the molecular formula C13H7NO5 and a molecular weight of 257.20 g/mol. Its IUPAC name is 2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylic acid.

Molecular Properties

Compound Name2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylic acid
PubChem CID121472574
Molecular FormulaC13H7NO5
Molecular Weight257.20 g/mol
Exact Mass257.03
IUPAC Name2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylic acid
SMILESCc1oc2c(c1C(=O)O)C(=O)c1ncccc1C2=O
InChIInChI=1S/C13H7NO5/c1-5-7(13(17)18)8-11(16)9-6(3-2-4-14-9)10(15)12(8)19-5/h2-4H,1H3,(H,17,18)
InChIKeyGCPJQRYMHLEJQY-UHFFFAOYSA-N
XLogP1.46
TPSA97.47 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.20
LogP ≤ 51.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}

Analyze 2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylic acid?
The IUPAC name of 2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylic acid (CID 121472574) is 2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylic acid.
What is the SMILES notation for 2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylic acid?
The canonical SMILES for 2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylic acid is Cc1oc2c(c1C(=O)O)C(=O)c1ncccc1C2=O.
What is the InChIKey of 2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylic acid?
The InChIKey is GCPJQRYMHLEJQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7NO5/c1-5-7(13(17)18)8-11(16)9-6(3-2-4-14-9)10(15)12(8)19-5/h2-4H,1H3,(H,17,18).
What are the key properties of 2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylic acid?
2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylic acid has a molecular weight of 257.20 g/mol, XLogP of 1.46, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylic acid is sourced from PubChem (CID 121472574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).