C13H7NO5 — CID 121472574
2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylic acid (PubChem CID 121472574) has the molecular formula C13H7NO5 and a molecular weight of 257.20 g/mol. Its IUPAC name is 2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylic acid.
| Compound Name | 2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 121472574 |
| Molecular Formula | C13H7NO5 |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 2-methyl-4,9-dioxofuro[2,3-g]quinoline-3-carboxylic acid |
| SMILES | Cc1oc2c(c1C(=O)O)C(=O)c1ncccc1C2=O |
| InChI | InChI=1S/C13H7NO5/c1-5-7(13(17)18)8-11(16)9-6(3-2-4-14-9)10(15)12(8)19-5/h2-4H,1H3,(H,17,18) |
| InChIKey | GCPJQRYMHLEJQY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|