C15H13NO6 — CID 121472572
2-(1-hydroxyethyl)-2-methyl-4,9-dioxo-3H-furo[2,3-g]quinoline-3-carboxylic acid (PubChem CID 121472572) has the molecular formula C15H13NO6 and a molecular weight of 303.27 g/mol. Its IUPAC name is 2-(1-hydroxyethyl)-2-methyl-4,9-dioxo-3H-furo[2,3-g]quinoline-3-carboxylic acid.
| Compound Name | 2-(1-hydroxyethyl)-2-methyl-4,9-dioxo-3H-furo[2,3-g]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 121472572 |
| Molecular Formula | C15H13NO6 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-(1-hydroxyethyl)-2-methyl-4,9-dioxo-3H-furo[2,3-g]quinoline-3-carboxylic acid |
| SMILES | CC(O)C1(C)OC2=C(C(=O)c3ncccc3C2=O)C1C(=O)O |
| InChI | InChI=1S/C15H13NO6/c1-6(17)15(2)9(14(20)21)8-12(19)10-7(4-3-5-16-10)11(18)13(8)22-15/h3-6,9,17H,1-2H3,(H,20,21) |
| InChIKey | ONYOSDSGKPBSKV-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 113.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|