C18H9NO4 — CID 142308028
2-benzoylfuro[3,2-g]quinoline-4,9-dione (PubChem CID 142308028) has the molecular formula C18H9NO4 and a molecular weight of 303.27 g/mol. Its IUPAC name is 2-benzoylfuro[3,2-g]quinoline-4,9-dione.
| Compound Name | 2-benzoylfuro[3,2-g]quinoline-4,9-dione |
|---|---|
| PubChem CID | 142308028 |
| Molecular Formula | C18H9NO4 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2-benzoylfuro[3,2-g]quinoline-4,9-dione |
| SMILES | O=C(c1ccccc1)c1cc2c(o1)C(=O)c1ncccc1C2=O |
| InChI | InChI=1S/C18H9NO4/c20-15(10-5-2-1-3-6-10)13-9-12-16(21)11-7-4-8-19-14(11)17(22)18(12)23-13/h1-9H |
| InChIKey | NAJYEVDOTOMRSA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 77.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|