C17H10N2O — CID 177439145
5-phenyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-one (PubChem CID 177439145) has the molecular formula C17H10N2O and a molecular weight of 258.28 g/mol. Its IUPAC name is 5-phenyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-one.
| Compound Name | 5-phenyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-one |
|---|---|
| PubChem CID | 177439145 |
| Molecular Formula | C17H10N2O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 5-phenyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-one |
| SMILES | O=C1c2cccnc2-c2ncc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C17H10N2O/c20-17-13-7-4-8-18-15(13)16-14(17)9-12(10-19-16)11-5-2-1-3-6-11/h1-10H |
| InChIKey | XDPUWINJQQCACG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |