C34H23N3O3 — CID 123278646
(6Z)-3,8-bis[4-(hydroxymethyl)phenyl]-6-[isocyano(phenyl)methylidene]-1,10-phenanthrolin-5-one (PubChem CID 123278646) has the molecular formula C34H23N3O3 and a molecular weight of 521.58 g/mol. Its IUPAC name is (6Z)-3,8-bis[4-(hydroxymethyl)phenyl]-6-[isocyano(phenyl)methylidene]-1,10-phenanthrolin-5-one.
| Compound Name | (6Z)-3,8-bis[4-(hydroxymethyl)phenyl]-6-[isocyano(phenyl)methylidene]-1,10-phenanthrolin-5-one |
|---|---|
| PubChem CID | 123278646 |
| Molecular Formula | C34H23N3O3 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | (6Z)-3,8-bis[4-(hydroxymethyl)phenyl]-6-[isocyano(phenyl)methylidene]-1,10-phenanthrolin-5-one |
| SMILES | [C-]#[N+]/C(=C1\C(=O)c2cc(-c3ccc(CO)cc3)cnc2-c2ncc(-c3ccc(CO)cc3)cc21)c1ccccc1 |
| InChI | InChI=1S/C34H23N3O3/c1-35-31(25-5-3-2-4-6-25)30-28-15-26(23-11-7-21(19-38)8-12-23)17-36-32(28)33-29(34(30)40)16-27(18-37-33)24-13-9-22(20-39)10-14-24/h2-18,38-39H,19-20H2/b31-30- |
| InChIKey | AYZBHEVWFWYWKM-KTMFPKCZSA-N |
| XLogP | 6.45 |
| TPSA | 87.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|