C28H23N3O — CID 58758706
3-[[4-(5-isocyano-3-phenyl-2-pyridinyl)phenyl]methylamino]-1-phenylpropan-1-one (PubChem CID 58758706) has the molecular formula C28H23N3O and a molecular weight of 417.51 g/mol. Its IUPAC name is 3-[[4-(5-isocyano-3-phenyl-2-pyridinyl)phenyl]methylamino]-1-phenylpropan-1-one.
| Compound Name | 3-[[4-(5-isocyano-3-phenyl-2-pyridinyl)phenyl]methylamino]-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 58758706 |
| Molecular Formula | C28H23N3O |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 3-[[4-(5-isocyano-3-phenyl-2-pyridinyl)phenyl]methylamino]-1-phenylpropan-1-one |
| SMILES | [C-]#[N+]c1cnc(-c2ccc(CNCCC(=O)c3ccccc3)cc2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C28H23N3O/c1-29-25-18-26(22-8-4-2-5-9-22)28(31-20-25)24-14-12-21(13-15-24)19-30-17-16-27(32)23-10-6-3-7-11-23/h2-15,18,20,30H,16-17,19H2 |
| InChIKey | JNCQCVLYYPVRIT-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 46.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|